C45H33N3O — CID 162783267
9,9-dimethyl-3-[1-phenyl-4-(3-phenyl-5-pyridin-2-ylphenyl)benzimidazol-2-yl]fluoren-2-ol (PubChem CID 162783267) has the molecular formula C45H33N3O and a molecular weight of 631.78 g/mol. Its IUPAC name is 9,9-dimethyl-3-[1-phenyl-4-(3-phenyl-5-pyridin-2-ylphenyl)benzimidazol-2-yl]fluoren-2-ol.
| Compound Name | 9,9-dimethyl-3-[1-phenyl-4-(3-phenyl-5-pyridin-2-ylphenyl)benzimidazol-2-yl]fluoren-2-ol |
|---|---|
| PubChem CID | 162783267 |
| Molecular Formula | C45H33N3O |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 9,9-dimethyl-3-[1-phenyl-4-(3-phenyl-5-pyridin-2-ylphenyl)benzimidazol-2-yl]fluoren-2-ol |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3nc4c(-c5cc(-c6ccccc6)cc(-c6ccccn6)c5)cccc4n3-c3ccccc3)c(O)cc21 |
| InChI | InChI=1S/C45H33N3O/c1-45(2)38-20-10-9-18-35(38)36-27-37(42(49)28-39(36)45)44-47-43-34(19-13-22-41(43)48(44)33-16-7-4-8-17-33)31-24-30(29-14-5-3-6-15-29)25-32(26-31)40-21-11-12-23-46-40/h3-28,49H,1-2H3 |
| InChIKey | XZURTTQZBFSHEO-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |