C56H47N4OPt- — CID 162784130
3-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]-9-phenylcarbazol-2-ol;platinum (PubChem CID 162784130) has the molecular formula C56H47N4OPt- and a molecular weight of 987.10 g/mol. Its IUPAC name is 3-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]-9-phenylcarbazol-2-ol;platinum.
| Compound Name | 3-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]-9-phenylcarbazol-2-ol;platinum |
|---|---|
| PubChem CID | 162784130 |
| Molecular Formula | C56H47N4OPt- |
| Molecular Weight | 987.10 g/mol |
| Exact Mass | 986.34 |
| IUPAC Name | 3-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)benzimidazol-2-yl]-9-phenylcarbazol-2-ol;platinum |
| SMILES | CC(C)(C)c1cc(-c2ccccn2)[c-]c(-c2cccc3c2nc(-c2cc4c5ccccc5n(-c5ccccc5)c4cc2O)n3-c2ccc(C(C)(C)C)cc2-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C56H47N4O.Pt/c1-55(2,3)39-27-28-49(44(33-39)36-18-9-7-10-19-36)60-50-26-17-23-42(37-30-38(47-24-15-16-29-57-47)32-40(31-37)56(4,5)6)53(50)58-54(60)46-34-45-43-22-13-14-25-48(43)59(51(45)35-52(46)61)41-20-11-8-12-21-41;/h7-29,31-35,61H,1-6H3;/q-1; |
| InChIKey | BBNVLQPVSIPBOO-UHFFFAOYSA-N |
| XLogP | 14.28 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.10 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|