C20H16FN5O — CID 162784463
3-[(4-fluoro-3-isocyanophenyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)pyrrolidin-2-one (PubChem CID 162784463) has the molecular formula C20H16FN5O and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-[(4-fluoro-3-isocyanophenyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)pyrrolidin-2-one.
| Compound Name | 3-[(4-fluoro-3-isocyanophenyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 162784463 |
| Molecular Formula | C20H16FN5O |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[(4-fluoro-3-isocyanophenyl)methyl]-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1cc(CC2CCN(c3cc(-c4ccncc4)[nH]n3)C2=O)ccc1F |
| InChI | InChI=1S/C20H16FN5O/c1-22-18-11-13(2-3-16(18)21)10-15-6-9-26(20(15)27)19-12-17(24-25-19)14-4-7-23-8-5-14/h2-5,7-8,11-12,15H,6,9-10H2,(H,24,25) |
| InChIKey | QSWZWJRQPWKSPJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|