C18H17NO4 — CID 162785880
methyl 6-(4-hydroxybut-1-ynyl)-3-phenylmethoxypyridine-2-carboxylate (PubChem CID 162785880) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 6-(4-hydroxybut-1-ynyl)-3-phenylmethoxypyridine-2-carboxylate.
| Compound Name | methyl 6-(4-hydroxybut-1-ynyl)-3-phenylmethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 162785880 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 6-(4-hydroxybut-1-ynyl)-3-phenylmethoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C#CCCO)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c1-22-18(21)17-16(23-13-14-7-3-2-4-8-14)11-10-15(19-17)9-5-6-12-20/h2-4,7-8,10-11,20H,6,12-13H2,1H3 |
| InChIKey | GFFZPYSHMFREIH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|