C14H20O2 — CID 162786802
(3aS,9aS)-2-hydroxy-3,3-dimethyl-2,3a,4,7,8,9-hexahydro-1H-cyclopenta[d]inden-5-one (PubChem CID 162786802) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (3aS,9aS)-2-hydroxy-3,3-dimethyl-2,3a,4,7,8,9-hexahydro-1H-cyclopenta[d]inden-5-one.
| Compound Name | (3aS,9aS)-2-hydroxy-3,3-dimethyl-2,3a,4,7,8,9-hexahydro-1H-cyclopenta[d]inden-5-one |
|---|---|
| PubChem CID | 162786802 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3aS,9aS)-2-hydroxy-3,3-dimethyl-2,3a,4,7,8,9-hexahydro-1H-cyclopenta[d]inden-5-one |
| SMILES | CC1(C)C(O)C[C@]23CCCC2=CC(=O)C[C@H]13 |
| InChI | InChI=1S/C14H20O2/c1-13(2)11-7-10(15)6-9-4-3-5-14(9,11)8-12(13)16/h6,11-12,16H,3-5,7-8H2,1-2H3/t11-,12?,14-/m1/s1 |
| InChIKey | MWAKKZJESFTYCV-YXHCSQSYSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |