C13H18O2 — CID 162786871
4-[(3,3-dimethyloxiran-2-yl)methyl]-2,4-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 162786871) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-[(3,3-dimethyloxiran-2-yl)methyl]-2,4-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[(3,3-dimethyloxiran-2-yl)methyl]-2,4-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 162786871 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-[(3,3-dimethyloxiran-2-yl)methyl]-2,4-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(C)(CC2OC2(C)C)C=CC1=O |
| InChI | InChI=1S/C13H18O2/c1-9-7-13(4,6-5-10(9)14)8-11-12(2,3)15-11/h5-7,11H,8H2,1-4H3 |
| InChIKey | NKCZRPLQGLVBMR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|