C25H23FeN3O3S — CID 162786962
cyclopenta-1,3-diene;iron(2+);N-[(E)-[2-[(4-methylphenyl)sulfonylamino]phenyl]methylideneamino]cyclopenta-1,3-diene-1-carboxamide (PubChem CID 162786962) has the molecular formula C25H23FeN3O3S and a molecular weight of 501.39 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);N-[(E)-[2-[(4-methylphenyl)sulfonylamino]phenyl]methylideneamino]cyclopenta-1,3-diene-1-carboxamide.
| Compound Name | cyclopenta-1,3-diene;iron(2+);N-[(E)-[2-[(4-methylphenyl)sulfonylamino]phenyl]methylideneamino]cyclopenta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 162786962 |
| Molecular Formula | C25H23FeN3O3S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);N-[(E)-[2-[(4-methylphenyl)sulfonylamino]phenyl]methylideneamino]cyclopenta-1,3-diene-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2/C=N/NC(=O)c2ccc[cH-]2)cc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C20H18N3O3S.C5H5.Fe/c1-15-10-12-18(13-11-15)27(25,26)23-19-9-5-4-8-17(19)14-21-22-20(24)16-6-2-3-7-16;1-2-4-5-3-1;/h2-14,23H,1H3,(H,22,24);1-5H;/q2*-1;+2/b21-14+;; |
| InChIKey | WCDUDCJHEOZVDN-NZYGGCLTSA-N |
| XLogP | 4.68 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|