C20H19N3O2S — CID 162787157
5-amino-3-methyl-2-N-(2-methylphenyl)-4-N-phenylthiophene-2,4-dicarboxamide (PubChem CID 162787157) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 5-amino-3-methyl-2-N-(2-methylphenyl)-4-N-phenylthiophene-2,4-dicarboxamide.
| Compound Name | 5-amino-3-methyl-2-N-(2-methylphenyl)-4-N-phenylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 162787157 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 5-amino-3-methyl-2-N-(2-methylphenyl)-4-N-phenylthiophene-2,4-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)c1sc(N)c(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C20H19N3O2S/c1-12-8-6-7-11-15(12)23-20(25)17-13(2)16(18(21)26-17)19(24)22-14-9-4-3-5-10-14/h3-11H,21H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | RXGBQWKBVKMUKI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|