C21H18F3N3O2S — CID 138490331
5-amino-3-methyl-2-N-phenyl-4-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2,4-dicarboxamide (PubChem CID 138490331) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 5-amino-3-methyl-2-N-phenyl-4-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2,4-dicarboxamide.
| Compound Name | 5-amino-3-methyl-2-N-phenyl-4-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 138490331 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-amino-3-methyl-2-N-phenyl-4-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2,4-dicarboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)sc(N)c1C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3N3O2S/c1-12-16(18(25)30-17(12)20(29)27-15-5-3-2-4-6-15)19(28)26-11-13-7-9-14(10-8-13)21(22,23)24/h2-10H,11,25H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | OEPYNFSCGCCUJS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|