C15H13F3N2O3S — CID 1129095
methyl 2-amino-4-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]thiophene-3-carboxylate (PubChem CID 1129095) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is methyl 2-amino-4-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]thiophene-3-carboxylate.
| Compound Name | methyl 2-amino-4-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1129095 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | methyl 2-amino-4-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N)sc(C(=O)Nc2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C15H13F3N2O3S/c1-7-10(14(22)23-2)12(19)24-11(7)13(21)20-9-5-3-4-8(6-9)15(16,17)18/h3-6H,19H2,1-2H3,(H,20,21) |
| InChIKey | GBJJEJSCRKJPPW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|