C16H21N3O4 — CID 162789722
N-[[4-[(3-cyanophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]-2-methoxyacetamide (PubChem CID 162789722) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[[4-[(3-cyanophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]-2-methoxyacetamide.
| Compound Name | N-[[4-[(3-cyanophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 162789722 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[[4-[(3-cyanophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCC1OCC(NCc2cccc(C#N)c2)C1O |
| InChI | InChI=1S/C16H21N3O4/c1-22-10-15(20)19-8-14-16(21)13(9-23-14)18-7-12-4-2-3-11(5-12)6-17/h2-5,13-14,16,18,21H,7-10H2,1H3,(H,19,20) |
| InChIKey | LQJWRBXHQCORRD-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |