C19H27N3O4 — CID 162789752
N-[[4-[(1-acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]benzamide (PubChem CID 162789752) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[[4-[(1-acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]benzamide.
| Compound Name | N-[[4-[(1-acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 162789752 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[[4-[(1-acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]benzamide |
| SMILES | CC(=O)N1CCC(NC2COC(CNC(=O)c3ccccc3)C2O)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-13(23)22-9-7-15(8-10-22)21-16-12-26-17(18(16)24)11-20-19(25)14-5-3-2-4-6-14/h2-6,15-18,21,24H,7-12H2,1H3,(H,20,25) |
| InChIKey | MJKYTIALISUBJQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |