C15H27N3O5 — CID 162967431
N-[[3-hydroxy-4-(oxan-4-ylamino)oxolan-2-yl]methyl]morpholine-4-carboxamide (PubChem CID 162967431) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[[3-hydroxy-4-(oxan-4-ylamino)oxolan-2-yl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[[3-hydroxy-4-(oxan-4-ylamino)oxolan-2-yl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 162967431 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[[3-hydroxy-4-(oxan-4-ylamino)oxolan-2-yl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCC1OCC(NC2CCOCC2)C1O)N1CCOCC1 |
| InChI | InChI=1S/C15H27N3O5/c19-14-12(17-11-1-5-21-6-2-11)10-23-13(14)9-16-15(20)18-3-7-22-8-4-18/h11-14,17,19H,1-10H2,(H,16,20) |
| InChIKey | FXGXAZWYLCFEJX-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |