C16H27N3O2 — CID 162790561
cyclopropyl-(8-propan-2-ylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)methanone (PubChem CID 162790561) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is cyclopropyl-(8-propan-2-ylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)methanone.
| Compound Name | cyclopropyl-(8-propan-2-ylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 162790561 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | cyclopropyl-(8-propan-2-ylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine]-1'-yl)methanone |
| SMILES | CC(C)N1CC2COCCN2C2(CN(C(=O)C3CC3)C2)C1 |
| InChI | InChI=1S/C16H27N3O2/c1-12(2)17-7-14-8-21-6-5-19(14)16(9-17)10-18(11-16)15(20)13-3-4-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | NCSRUXDNCKVPFM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |