C37H47N6O3- — CID 162791256
[1-[1-(4-aminooctyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxybut-3-en-2-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162791256) has the molecular formula C37H47N6O3- and a molecular weight of 623.82 g/mol. Its IUPAC name is [1-[1-(4-aminooctyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxybut-3-en-2-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [1-[1-(4-aminooctyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxybut-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162791256 |
| Molecular Formula | C37H47N6O3- |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.37 |
| IUPAC Name | [1-[1-(4-aminooctyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxybut-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | CCCCC(N)CCCC1c2cc3cc(CC=O)ccc3cc2C=CC1CC([N-]c1ccc[nH]1)C(=CC(=O)O)C1CCN=C(N)N1 |
| InChI | InChI=1S/C37H47N6O3/c1-2-3-6-29(38)7-4-8-30-27(13-12-26-20-25-11-10-24(15-18-44)19-28(25)21-31(26)30)22-34(42-35-9-5-16-40-35)32(23-36(45)46)33-14-17-41-37(39)43-33/h5,9-13,16,18-21,23,27,29-30,33-34,40H,2-4,6-8,14-15,17,22,38H2,1H3,(H,45,46)(H3,39,41,43)/q-1 |
| InChIKey | MITCRNPPJXTXCA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 160.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|