C37H49N6O4- — CID 162801188
[1-[1-(4-amino-10-hydroxydecyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-4-carboxy-3-[(diaminomethylideneamino)methyl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162801188) has the molecular formula C37H49N6O4- and a molecular weight of 641.84 g/mol. Its IUPAC name is [1-[1-(4-amino-10-hydroxydecyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-4-carboxy-3-[(diaminomethylideneamino)methyl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [1-[1-(4-amino-10-hydroxydecyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-4-carboxy-3-[(diaminomethylideneamino)methyl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162801188 |
| Molecular Formula | C37H49N6O4- |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.38 |
| IUPAC Name | [1-[1-(4-amino-10-hydroxydecyl)-7-(2-oxoethyl)-1,2-dihydroanthracen-2-yl]-4-carboxy-3-[(diaminomethylideneamino)methyl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | NC(N)=NCC(=CC(=O)O)C(CC1C=Cc2cc3ccc(CC=O)cc3cc2C1CCCC(N)CCCCCCO)[N-]c1ccc[nH]1 |
| InChI | InChI=1S/C37H49N6O4/c38-31(7-3-1-2-4-17-44)8-5-9-32-28(14-13-27-20-26-12-11-25(15-18-45)19-29(26)21-33(27)32)22-34(43-35-10-6-16-41-35)30(23-36(46)47)24-42-37(39)40/h6,10-14,16,18-21,23,28,31-32,34,41,44H,1-5,7-9,15,17,22,24,38H2,(H,46,47)(H4,39,40,42)/q-1 |
| InChIKey | HHPDAXPHNXGYCG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 194.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|