C33H44N5O3- — CID 162794544
[4-carboxy-3-[(diaminomethylideneamino)methyl]-1-[1-(4-hydroxyoctyl)-1,2,3,4-tetrahydroanthracen-2-yl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162794544) has the molecular formula C33H44N5O3- and a molecular weight of 558.75 g/mol. Its IUPAC name is [4-carboxy-3-[(diaminomethylideneamino)methyl]-1-[1-(4-hydroxyoctyl)-1,2,3,4-tetrahydroanthracen-2-yl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [4-carboxy-3-[(diaminomethylideneamino)methyl]-1-[1-(4-hydroxyoctyl)-1,2,3,4-tetrahydroanthracen-2-yl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162794544 |
| Molecular Formula | C33H44N5O3- |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | [4-carboxy-3-[(diaminomethylideneamino)methyl]-1-[1-(4-hydroxyoctyl)-1,2,3,4-tetrahydroanthracen-2-yl]but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | CCCCC(O)CCCC1c2cc3ccccc3cc2CCC1CC([N-]c1ccc[nH]1)C(=CC(=O)O)CN=C(N)N |
| InChI | InChI=1S/C33H44N5O3/c1-2-3-10-27(39)11-6-12-28-25(15-14-24-17-22-8-4-5-9-23(22)18-29(24)28)19-30(38-31-13-7-16-36-31)26(20-32(40)41)21-37-33(34)35/h4-5,7-9,13,16-18,20,25,27-28,30,36,39H,2-3,6,10-12,14-15,19,21H2,1H3,(H,40,41)(H4,34,35,37)/q-1 |
| InChIKey | WWIUVKXAEVOBAU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 151.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|