C30H42N5O3- — CID 162794370
[(E,3R,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-methyl-14-oxo-6-[(E)-2-phenylethenyl]tetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162794370) has the molecular formula C30H42N5O3- and a molecular weight of 520.70 g/mol. Its IUPAC name is [(E,3R,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-methyl-14-oxo-6-[(E)-2-phenylethenyl]tetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [(E,3R,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-methyl-14-oxo-6-[(E)-2-phenylethenyl]tetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162794370 |
| Molecular Formula | C30H42N5O3- |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | [(E,3R,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-methyl-14-oxo-6-[(E)-2-phenylethenyl]tetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | C[C@H](C=O)CCCCCC[C@H](/C=C/c1ccccc1)CC[C@@H]([N-]c1ccc[nH]1)/C(=C/C(=O)O)CN=C(N)N |
| InChI | InChI=1S/C30H42N5O3/c1-23(22-36)10-5-2-3-6-13-25(16-15-24-11-7-4-8-12-24)17-18-27(35-28-14-9-19-33-28)26(20-29(37)38)21-34-30(31)32/h4,7-9,11-12,14-16,19-20,22-23,25,27,33H,2-3,5-6,10,13,17-18,21H2,1H3,(H,37,38)(H4,31,32,34)/q-1/b16-15+,26-20+/t23-,25+,27+/m0/s1 |
| InChIKey | FYBIYGYDKJRARM-QYVCMXFPSA-N |
| XLogP | 5.96 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|