C31H46N6O2 — CID 162842911
(Z,4R,7S,11S)-11-amino-3-[(6S)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]-7-[(E)-2-phenylethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid (PubChem CID 162842911) has the molecular formula C31H46N6O2 and a molecular weight of 534.75 g/mol. Its IUPAC name is (Z,4R,7S,11S)-11-amino-3-[(6S)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]-7-[(E)-2-phenylethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid.
| Compound Name | (Z,4R,7S,11S)-11-amino-3-[(6S)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]-7-[(E)-2-phenylethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162842911 |
| Molecular Formula | C31H46N6O2 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | (Z,4R,7S,11S)-11-amino-3-[(6S)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]-7-[(E)-2-phenylethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
| SMILES | CCCC[C@H](N)CCCC(/C=C/c1ccccc1)CC[C@@H](Nc1ccc[nH]1)/C(=C/C(=O)O)[C@@H]1CCN=C(N)N1 |
| InChI | InChI=1S/C31H46N6O2/c1-2-3-12-25(32)13-7-11-24(16-15-23-9-5-4-6-10-23)17-18-27(36-29-14-8-20-34-29)26(22-30(38)39)28-19-21-35-31(33)37-28/h4-6,8-10,14-16,20,22,24-25,27-28,34,36H,2-3,7,11-13,17-19,21,32H2,1H3,(H,38,39)(H3,33,35,37)/b16-15+,26-22-/t24?,25-,27+,28-/m0/s1 |
| InChIKey | HCLXEVMDBHKQIB-AJLJSTQPSA-N |
| XLogP | 5.28 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|