C27H42N6O3 — CID 162795570
(E,4R,7R)-3-[(diaminomethylideneamino)methyl]-7-[(6-oxo-1H-pyridin-3-yl)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid (PubChem CID 162795570) has the molecular formula C27H42N6O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is (E,4R,7R)-3-[(diaminomethylideneamino)methyl]-7-[(6-oxo-1H-pyridin-3-yl)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid.
| Compound Name | (E,4R,7R)-3-[(diaminomethylideneamino)methyl]-7-[(6-oxo-1H-pyridin-3-yl)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162795570 |
| Molecular Formula | C27H42N6O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | (E,4R,7R)-3-[(diaminomethylideneamino)methyl]-7-[(6-oxo-1H-pyridin-3-yl)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
| SMILES | CCCCCCCC[C@H](CC[C@@H](Nc1ccc[nH]1)/C(=C/C(=O)O)CN=C(N)N)Cc1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C27H42N6O3/c1-2-3-4-5-6-7-9-20(16-21-12-14-25(34)31-18-21)11-13-23(33-24-10-8-15-30-24)22(17-26(35)36)19-32-27(28)29/h8,10,12,14-15,17-18,20,23,30,33H,2-7,9,11,13,16,19H2,1H3,(H,31,34)(H,35,36)(H4,28,29,32)/b22-17+/t20-,23-/m1/s1 |
| InChIKey | LGAZNCJIUZGTDO-WXRIWMHGSA-N |
| XLogP | 4.16 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|