C19H38N4O2 — CID 162935390
(Z,4R)-3-[(diaminomethylideneamino)methyl]-4-(methylaminomethyl)pentadec-2-enoic acid (PubChem CID 162935390) has the molecular formula C19H38N4O2 and a molecular weight of 354.54 g/mol. Its IUPAC name is (Z,4R)-3-[(diaminomethylideneamino)methyl]-4-(methylaminomethyl)pentadec-2-enoic acid.
| Compound Name | (Z,4R)-3-[(diaminomethylideneamino)methyl]-4-(methylaminomethyl)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162935390 |
| Molecular Formula | C19H38N4O2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (Z,4R)-3-[(diaminomethylideneamino)methyl]-4-(methylaminomethyl)pentadec-2-enoic acid |
| SMILES | CCCCCCCCCCC[C@@H](CNC)/C(=C/C(=O)O)CN=C(N)N |
| InChI | InChI=1S/C19H38N4O2/c1-3-4-5-6-7-8-9-10-11-12-16(14-22-2)17(13-18(24)25)15-23-19(20)21/h13,16,22H,3-12,14-15H2,1-2H3,(H,24,25)(H4,20,21,23)/b17-13+/t16-/m0/s1 |
| InChIKey | CRXIHEBHZSELIT-YKBBIGDRSA-N |
| XLogP | 3.03 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|