C28H43N5O2 — CID 162794508
(E,4R,7R)-7-benzyl-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid (PubChem CID 162794508) has the molecular formula C28H43N5O2 and a molecular weight of 481.69 g/mol. Its IUPAC name is (E,4R,7R)-7-benzyl-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid.
| Compound Name | (E,4R,7R)-7-benzyl-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162794508 |
| Molecular Formula | C28H43N5O2 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | (E,4R,7R)-7-benzyl-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
| SMILES | CCCCCCCCC(CC[C@@H](Nc1ccc[nH]1)/C(=C/C(=O)O)CN=C(N)N)Cc1ccccc1 |
| InChI | InChI=1S/C28H43N5O2/c1-2-3-4-5-6-8-14-23(19-22-12-9-7-10-13-22)16-17-25(33-26-15-11-18-31-26)24(20-27(34)35)21-32-28(29)30/h7,9-13,15,18,20,23,25,31,33H,2-6,8,14,16-17,19,21H2,1H3,(H,34,35)(H4,29,30,32)/b24-20+/t23?,25-/m1/s1 |
| InChIKey | KFRAMXFIEISFMN-JJWCWYHVSA-N |
| XLogP | 5.47 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|