C31H45N5O3 — CID 162875735
(E,4R,7S)-3-[(diaminomethylideneamino)methyl]-7-[(E)-2-[3-(2-oxoethyl)phenyl]ethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid (PubChem CID 162875735) has the molecular formula C31H45N5O3 and a molecular weight of 535.73 g/mol. Its IUPAC name is (E,4R,7S)-3-[(diaminomethylideneamino)methyl]-7-[(E)-2-[3-(2-oxoethyl)phenyl]ethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid.
| Compound Name | (E,4R,7S)-3-[(diaminomethylideneamino)methyl]-7-[(E)-2-[3-(2-oxoethyl)phenyl]ethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162875735 |
| Molecular Formula | C31H45N5O3 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | (E,4R,7S)-3-[(diaminomethylideneamino)methyl]-7-[(E)-2-[3-(2-oxoethyl)phenyl]ethenyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
| SMILES | CCCCCCCC[C@H](/C=C/c1cccc(CC=O)c1)CC[C@@H](Nc1ccc[nH]1)/C(=C/C(=O)O)CN=C(N)N |
| InChI | InChI=1S/C31H45N5O3/c1-2-3-4-5-6-7-10-24(14-15-25-11-8-12-26(21-25)18-20-37)16-17-28(36-29-13-9-19-34-29)27(22-30(38)39)23-35-31(32)33/h8-9,11-15,19-22,24,28,34,36H,2-7,10,16-18,23H2,1H3,(H,38,39)(H4,32,33,35)/b15-14+,27-22+/t24-,28-/m1/s1 |
| InChIKey | QFBIYRSUNNNFCP-HUDGTZRMSA-N |
| XLogP | 5.68 |
| TPSA | 146.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|