C19H32N2O2 — CID 162836539
(E,4R)-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid (PubChem CID 162836539) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (E,4R)-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid.
| Compound Name | (E,4R)-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162836539 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (E,4R)-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
| SMILES | CCCCCCCCCCC[C@H](/C=C/C(=O)O)Nc1ccc[nH]1 |
| InChI | InChI=1S/C19H32N2O2/c1-2-3-4-5-6-7-8-9-10-12-17(14-15-19(22)23)21-18-13-11-16-20-18/h11,13-17,20-21H,2-10,12H2,1H3,(H,22,23)/b15-14+/t17-/m1/s1 |
| InChIKey | SWUMYXVYXYVMMU-IAOULYHDSA-N |
| XLogP | 5.36 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|