C29H42N6O2 — CID 162791225
7-[(3-cyanophenyl)methyl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid (PubChem CID 162791225) has the molecular formula C29H42N6O2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 7-[(3-cyanophenyl)methyl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid.
| Compound Name | 7-[(3-cyanophenyl)methyl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162791225 |
| Molecular Formula | C29H42N6O2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 7-[(3-cyanophenyl)methyl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pentadec-2-enoic acid |
| SMILES | CCCCCCCCC(CCC(Nc1ccc[nH]1)C(=CC(=O)O)CN=C(N)N)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C29H42N6O2/c1-2-3-4-5-6-7-10-22(17-23-11-8-12-24(18-23)20-30)14-15-26(35-27-13-9-16-33-27)25(19-28(36)37)21-34-29(31)32/h8-9,11-13,16,18-19,22,26,33,35H,2-7,10,14-15,17,21H2,1H3,(H,36,37)(H4,31,32,34) |
| InChIKey | MVVZNGSCSQBCMV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|