C33H47N5O3 — CID 162823966
(E,4S,7S)-3-[(diaminomethylideneamino)methyl]-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid (PubChem CID 162823966) has the molecular formula C33H47N5O3 and a molecular weight of 561.77 g/mol. Its IUPAC name is (E,4S,7S)-3-[(diaminomethylideneamino)methyl]-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid.
| Compound Name | (E,4S,7S)-3-[(diaminomethylideneamino)methyl]-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid |
|---|---|
| PubChem CID | 162823966 |
| Molecular Formula | C33H47N5O3 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.37 |
| IUPAC Name | (E,4S,7S)-3-[(diaminomethylideneamino)methyl]-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid |
| SMILES | NC(N)=NC/C(=C\C(=O)O)[C@H](CC[C@H](CCCCCCCCCCO)c1ccc2ccccc2c1)Nc1ccc[nH]1 |
| InChI | InChI=1S/C33H47N5O3/c34-33(35)37-24-29(23-32(40)41)30(38-31-15-11-20-36-31)19-18-26(12-7-5-3-1-2-4-6-10-21-39)28-17-16-25-13-8-9-14-27(25)22-28/h8-9,11,13-17,20,22-23,26,30,36,38-39H,1-7,10,12,18-19,21,24H2,(H,40,41)(H4,34,35,37)/b29-23+/t26-,30-/m0/s1 |
| InChIKey | ZPYGTSODIKPEJB-FTMAOUFTSA-N |
| XLogP | 6.30 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|