C34H47N5O4 — CID 162794379
(E,4S,7S,14S)-3-[(diaminomethylideneamino)methyl]-14-formyl-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid (PubChem CID 162794379) has the molecular formula C34H47N5O4 and a molecular weight of 589.78 g/mol. Its IUPAC name is (E,4S,7S,14S)-3-[(diaminomethylideneamino)methyl]-14-formyl-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid.
| Compound Name | (E,4S,7S,14S)-3-[(diaminomethylideneamino)methyl]-14-formyl-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid |
|---|---|
| PubChem CID | 162794379 |
| Molecular Formula | C34H47N5O4 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | (E,4S,7S,14S)-3-[(diaminomethylideneamino)methyl]-14-formyl-17-hydroxy-7-naphthalen-2-yl-4-(1H-pyrrol-2-ylamino)heptadec-2-enoic acid |
| SMILES | NC(N)=NC/C(=C\C(=O)O)[C@H](CC[C@H](CCCCCC[C@H](C=O)CCCO)c1ccc2ccccc2c1)Nc1ccc[nH]1 |
| InChI | InChI=1S/C34H47N5O4/c35-34(36)38-23-30(22-33(42)43)31(39-32-14-7-19-37-32)18-17-27(29-16-15-26-12-5-6-13-28(26)21-29)11-4-2-1-3-9-25(24-41)10-8-20-40/h5-7,12-16,19,21-22,24-25,27,31,37,39-40H,1-4,8-11,17-18,20,23H2,(H,42,43)(H4,35,36,38)/b30-22+/t25-,27-,31-/m0/s1 |
| InChIKey | GLQKXPUUFQSRRT-NUGZGNNRSA-N |
| XLogP | 5.72 |
| TPSA | 166.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|