C34H46N5O4- — CID 162794378
[(E,3S,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-formyl-16-hydroxy-6-naphthalen-2-ylhexadec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162794378) has the molecular formula C34H46N5O4- and a molecular weight of 588.77 g/mol. Its IUPAC name is [(E,3S,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-formyl-16-hydroxy-6-naphthalen-2-ylhexadec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [(E,3S,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-formyl-16-hydroxy-6-naphthalen-2-ylhexadec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162794378 |
| Molecular Formula | C34H46N5O4- |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | [(E,3S,6S,13S)-1-carboxy-2-[(diaminomethylideneamino)methyl]-13-formyl-16-hydroxy-6-naphthalen-2-ylhexadec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | NC(N)=NC/C(=C\C(=O)O)[C@H](CC[C@H](CCCCCC[C@H](C=O)CCCO)c1ccc2ccccc2c1)[N-]c1ccc[nH]1 |
| InChI | InChI=1S/C34H46N5O4/c35-34(36)38-23-30(22-33(42)43)31(39-32-14-7-19-37-32)18-17-27(29-16-15-26-12-5-6-13-28(26)21-29)11-4-2-1-3-9-25(24-41)10-8-20-40/h5-7,12-16,19,21-22,24-25,27,31,37,40H,1-4,8-11,17-18,20,23H2,(H,42,43)(H4,35,36,38)/q-1/b30-22+/t25-,27-,31-/m0/s1 |
| InChIKey | XYPLJSXTDVBGPZ-NUGZGNNRSA-N |
| XLogP | 6.32 |
| TPSA | 168.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|