C24H34O3 — CID 162827675
(E,7S,14S)-14-methyl-15-oxo-7-[(E)-2-phenylethenyl]pentadec-2-enoic acid (PubChem CID 162827675) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (E,7S,14S)-14-methyl-15-oxo-7-[(E)-2-phenylethenyl]pentadec-2-enoic acid.
| Compound Name | (E,7S,14S)-14-methyl-15-oxo-7-[(E)-2-phenylethenyl]pentadec-2-enoic acid |
|---|---|
| PubChem CID | 162827675 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (E,7S,14S)-14-methyl-15-oxo-7-[(E)-2-phenylethenyl]pentadec-2-enoic acid |
| SMILES | C[C@H](C=O)CCCCCCC(/C=C/c1ccccc1)CCC/C=C/C(=O)O |
| InChI | InChI=1S/C24H34O3/c1-21(20-25)12-6-2-3-7-13-22(16-10-5-11-17-24(26)27)18-19-23-14-8-4-9-15-23/h4,8-9,11,14-15,17-22H,2-3,5-7,10,12-13,16H2,1H3,(H,26,27)/b17-11+,19-18+/t21-,22?/m0/s1 |
| InChIKey | QLLUYCSALJRPQW-UGKFEURMSA-N |
| XLogP | 6.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|