C26H35N3O7S2 — CID 162793905
2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-14-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine (PubChem CID 162793905) has the molecular formula C26H35N3O7S2 and a molecular weight of 565.71 g/mol. Its IUPAC name is 2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-14-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine.
| Compound Name | 2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-14-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine |
|---|---|
| PubChem CID | 162793905 |
| Molecular Formula | C26H35N3O7S2 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[(4R,12R,14R)-7-cyclopentyloxy-12-hydroxy-14-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-9-oxo-3,20-dioxa-16,17-dithiatetracyclo[9.7.2.02,6.08,19]icosa-1(19),2(6),7,10-tetraen-14-yl]guanidine |
| SMILES | CC(C)(O)[C@H]1Cc2c(c3c4oc(cc(=O)c4c2OC2CCCC2)[C@H](O)C[C@](CO)(N=C(N)N)CSSC3)O1 |
| InChI | InChI=1S/C26H35N3O7S2/c1-25(2,33)19-7-14-21(36-19)15-10-37-38-12-26(11-30,29-24(27)28)9-17(32)18-8-16(31)20(23(15)35-18)22(14)34-13-5-3-4-6-13/h8,13,17,19,30,32-33H,3-7,9-12H2,1-2H3,(H4,27,28,29)/t17-,19-,26-/m1/s1 |
| InChIKey | SUAOGIISFAWKDJ-MIRXNBLZSA-N |
| XLogP | 2.51 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|