About N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide
N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide (PubChem CID 162800007) has the molecular formula C18H33N3O4
and a molecular weight of 355.48 g/mol. Its IUPAC name is N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide.
Molecular Properties
| Compound Name | N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide |
| PubChem CID | 162800007 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NC1COC(CN2CCCN(C(C)=O)CC2)C1O |
| InChI | InChI=1S/C18H33N3O4/c1-4-14(5-2)18(24)19-15-12-25-16(17(15)23)11-20-7-6-8-21(10-9-20)13(3)22/h14-17,23H,4-12H2,1-3H3,(H,19,24) |
| InChIKey | AEHJKTXHDXHRFM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide?
The IUPAC name of N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide (CID 162800007) is N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide.
What is the SMILES notation for N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide?
The canonical SMILES for N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide is CCC(CC)C(=O)NC1COC(CN2CCCN(C(C)=O)CC2)C1O.
What is the InChIKey of N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide?
The InChIKey is AEHJKTXHDXHRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3O4/c1-4-14(5-2)18(24)19-15-12-25-16(17(15)23)11-20-7-6-8-21(10-9-20)13(3)22/h14-17,23H,4-12H2,1-3H3,(H,19,24).
What are the key properties of N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide?
N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide has a molecular weight of 355.48 g/mol, XLogP of 0.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(4-acetyl-1,4-diazepan-1-yl)methyl]-4-hydroxyoxolan-3-yl]-2-ethylbutanamide is sourced from PubChem (CID 162800007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).