C13H25N3O3 — CID 162800021
1-[4-[[4-(dimethylamino)-3-hydroxyoxolan-2-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 162800021) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)-3-hydroxyoxolan-2-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-(dimethylamino)-3-hydroxyoxolan-2-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 162800021 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)-3-hydroxyoxolan-2-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC2OCC(N(C)C)C2O)CC1 |
| InChI | InChI=1S/C13H25N3O3/c1-10(17)16-6-4-15(5-7-16)8-12-13(18)11(9-19-12)14(2)3/h11-13,18H,4-9H2,1-3H3 |
| InChIKey | NSBDEJMZEHFHNK-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |