C20H30O3 — CID 162800845
1,6,12-trimethyl-9-prop-1-en-2-yl-5,16-dioxatricyclo[13.1.0.04,6]hexadeca-9,11-dien-8-ol (PubChem CID 162800845) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1,6,12-trimethyl-9-prop-1-en-2-yl-5,16-dioxatricyclo[13.1.0.04,6]hexadeca-9,11-dien-8-ol.
| Compound Name | 1,6,12-trimethyl-9-prop-1-en-2-yl-5,16-dioxatricyclo[13.1.0.04,6]hexadeca-9,11-dien-8-ol |
|---|---|
| PubChem CID | 162800845 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1,6,12-trimethyl-9-prop-1-en-2-yl-5,16-dioxatricyclo[13.1.0.04,6]hexadeca-9,11-dien-8-ol |
| SMILES | C=C(C)C1=CC=C(C)CCC2OC2(C)CCC2OC2(C)CC1O |
| InChI | InChI=1S/C20H30O3/c1-13(2)15-8-6-14(3)7-9-17-19(4,22-17)11-10-18-20(5,23-18)12-16(15)21/h6,8,16-18,21H,1,7,9-12H2,2-5H3 |
| InChIKey | XOQRLJYANAGGQG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|