C20H32O2 — CID 20847666
(4E,8Z,10Z)-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-ol (PubChem CID 20847666) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (4E,8Z,10Z)-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-ol.
| Compound Name | (4E,8Z,10Z)-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-ol |
|---|---|
| PubChem CID | 20847666 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4E,8Z,10Z)-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-ol |
| SMILES | C/C1=C/C=C(\C(C)C)CCC2(C)OC2CC/C(C)=C/CC1O |
| InChI | InChI=1S/C20H32O2/c1-14(2)17-9-8-16(4)18(21)10-6-15(3)7-11-19-20(5,22-19)13-12-17/h6,8-9,14,18-19,21H,7,10-13H2,1-5H3/b15-6+,16-8-,17-9- |
| InChIKey | KFTGFYDAJPEXTO-QQCOEEBESA-N |
| XLogP | 4.94 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|