C22H34O4 — CID 162970612
2-[(1S,2E,6R,8R,11E,15R)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-dien-3-yl]propyl acetate (PubChem CID 162970612) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[(1S,2E,6R,8R,11E,15R)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-dien-3-yl]propyl acetate.
| Compound Name | 2-[(1S,2E,6R,8R,11E,15R)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-dien-3-yl]propyl acetate |
|---|---|
| PubChem CID | 162970612 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[(1S,2E,6R,8R,11E,15R)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-dien-3-yl]propyl acetate |
| SMILES | CC(=O)OCC(C)/C1=C/[C@@H]2O[C@]2(C)CC/C=C(\C)CC[C@H]2O[C@]2(C)CC1 |
| InChI | InChI=1S/C22H34O4/c1-15-7-6-11-21(4)20(26-21)13-18(16(2)14-24-17(3)23)10-12-22(5)19(25-22)9-8-15/h7,13,16,19-20H,6,8-12,14H2,1-5H3/b15-7+,18-13+/t16?,19-,20+,21-,22-/m1/s1 |
| InChIKey | DNKIONNROSAFRO-QDSRWJPWSA-N |
| XLogP | 4.73 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|