C16H26N+ — CID 162800855
(1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl)-methylidyneazanium (PubChem CID 162800855) has the molecular formula C16H26N+ and a molecular weight of 232.39 g/mol. Its IUPAC name is (1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl)-methylidyneazanium.
| Compound Name | (1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl)-methylidyneazanium |
|---|---|
| PubChem CID | 162800855 |
| Molecular Formula | C16H26N+ |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.21 |
| IUPAC Name | (1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl)-methylidyneazanium |
| SMILES | C#[N+]C1(C)CCC(C(C)C)C2C=C(C)CCC21 |
| InChI | InChI=1S/C16H26N/c1-11(2)13-8-9-16(4,17-5)15-7-6-12(3)10-14(13)15/h5,10-11,13-15H,6-9H2,1-4H3/q+1 |
| InChIKey | ZMRSIKCBWWLYCQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|