C10H20N4O3 — CID 162801560
(2S)-2-amino-5-(4-carbamoyldiazinan-1-yl)pentanoic acid (PubChem CID 162801560) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S)-2-amino-5-(4-carbamoyldiazinan-1-yl)pentanoic acid.
| Compound Name | (2S)-2-amino-5-(4-carbamoyldiazinan-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 162801560 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2S)-2-amino-5-(4-carbamoyldiazinan-1-yl)pentanoic acid |
| SMILES | NC(=O)C1CCN(CCC[C@H](N)C(=O)O)NC1 |
| InChI | InChI=1S/C10H20N4O3/c11-8(10(16)17)2-1-4-14-5-3-7(6-13-14)9(12)15/h7-8,13H,1-6,11H2,(H2,12,15)(H,16,17)/t7?,8-/m0/s1 |
| InChIKey | BJVRJQOYGCWXAR-MQWKRIRWSA-N |
| XLogP | -1.51 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |