C26H48N5+ — CID 162801775
7-[5-(1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine (PubChem CID 162801775) has the molecular formula C26H48N5+ and a molecular weight of 430.71 g/mol. Its IUPAC name is 7-[5-(1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine.
| Compound Name | 7-[5-(1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine |
|---|---|
| PubChem CID | 162801775 |
| Molecular Formula | C26H48N5+ |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.39 |
| IUPAC Name | 7-[5-(1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine |
| SMILES | CC(=CCN1C[NH+](C)C2NCNC(N)C21)CCC1(C)C2=CCCC(C)C2(C)CCC1C |
| InChI | InChI=1S/C26H47N5/c1-18(12-15-31-17-30(6)24-22(31)23(27)28-16-29-24)10-13-25(4)20(3)11-14-26(5)19(2)8-7-9-21(25)26/h9,12,19-20,22-24,28-29H,7-8,10-11,13-17,27H2,1-6H3/p+1 |
| InChIKey | CYYXPNGSVQTKSR-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|