C26H47N5 — CID 162803523
7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-2,3,4,5,6,8-hexahydro-1H-purin-6-amine (PubChem CID 162803523) has the molecular formula C26H47N5 and a molecular weight of 429.70 g/mol. Its IUPAC name is 7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-2,3,4,5,6,8-hexahydro-1H-purin-6-amine.
| Compound Name | 7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-2,3,4,5,6,8-hexahydro-1H-purin-6-amine |
|---|---|
| PubChem CID | 162803523 |
| Molecular Formula | C26H47N5 |
| Molecular Weight | 429.70 g/mol |
| Exact Mass | 429.38 |
| IUPAC Name | 7-[5-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-2,3,4,5,6,8-hexahydro-1H-purin-6-amine |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1CCC(C)=CCN1CN(C)C2NCNC(N)C21 |
| InChI | InChI=1S/C26H47N5/c1-18(12-15-31-17-30(6)24-22(31)23(27)28-16-29-24)8-10-20-19(2)9-11-21-25(3,4)13-7-14-26(20,21)5/h12,20-24,28-29H,2,7-11,13-17,27H2,1,3-6H3 |
| InChIKey | GZCGKBVNLJYPIV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|