C23H23N3O4S — CID 162803324
(1S,2R,6S,7R,11R)-3-(furan-2-ylmethyl)-11-hydroxy-5-[(1-methylindol-3-yl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one (PubChem CID 162803324) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is (1S,2R,6S,7R,11R)-3-(furan-2-ylmethyl)-11-hydroxy-5-[(1-methylindol-3-yl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one.
| Compound Name | (1S,2R,6S,7R,11R)-3-(furan-2-ylmethyl)-11-hydroxy-5-[(1-methylindol-3-yl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
|---|---|
| PubChem CID | 162803324 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (1S,2R,6S,7R,11R)-3-(furan-2-ylmethyl)-11-hydroxy-5-[(1-methylindol-3-yl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
| SMILES | Cn1cc(CN2C(=S)N(Cc3ccco3)[C@H]3[C@H]2[C@H]2OC(=O)[C@H]3C[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C23H23N3O4S/c1-24-10-13(15-6-2-3-7-17(15)24)11-25-20-19(16-9-18(27)21(20)30-22(16)28)26(23(25)31)12-14-5-4-8-29-14/h2-8,10,16,18-21,27H,9,11-12H2,1H3/t16-,18+,19+,20-,21-/m0/s1 |
| InChIKey | NHRNUEFGKHWONF-MYGYKHERSA-N |
| XLogP | 2.42 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|