C19H27N3O5 — CID 162804970
1-[[(2S,3S,4R,5S)-5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-3-propan-2-ylurea (PubChem CID 162804970) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[[(2S,3S,4R,5S)-5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[(2S,3S,4R,5S)-5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 162804970 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[[(2S,3S,4R,5S)-5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC[C@@H]1O[C@@H](CC(=O)N2CCc3ccccc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H27N3O5/c1-11(2)21-19(26)20-10-15-18(25)17(24)14(27-15)9-16(23)22-8-7-12-5-3-4-6-13(12)22/h3-6,11,14-15,17-18,24-25H,7-10H2,1-2H3,(H2,20,21,26)/t14-,15-,17-,18+/m0/s1 |
| InChIKey | HLHXTNKEYZALHV-UOVPBQLFSA-N |
| XLogP | 0.16 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |