C21H24O12 — CID 162808213
(2R)-3-(3,4-dihydroxyphenyl)-1-[2,4-dihydroxy-3-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2-hydroxypropan-1-one (PubChem CID 162808213) has the molecular formula C21H24O12 and a molecular weight of 468.41 g/mol. Its IUPAC name is (2R)-3-(3,4-dihydroxyphenyl)-1-[2,4-dihydroxy-3-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2-hydroxypropan-1-one.
| Compound Name | (2R)-3-(3,4-dihydroxyphenyl)-1-[2,4-dihydroxy-3-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 162808213 |
| Molecular Formula | C21H24O12 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-1-[2,4-dihydroxy-3-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2-hydroxypropan-1-one |
| SMILES | O=C(c1ccc(O)c(O[C@H]2O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)c1O)[C@H](O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H24O12/c22-7-14-17(29)18(30)19(31)21(32-14)33-20-11(24)4-2-9(16(20)28)15(27)13(26)6-8-1-3-10(23)12(25)5-8/h1-5,13-14,17-19,21-26,28-31H,6-7H2/t13-,14+,17-,18-,19-,21-/m1/s1 |
| InChIKey | AWIHQVHQMCMMHE-TUIUEMMQSA-N |
| XLogP | -1.53 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|