C39H62O5 — CID 162809906
[(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] octadeca-6,9,12-trienoate (PubChem CID 162809906) has the molecular formula C39H62O5 and a molecular weight of 610.92 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] octadeca-6,9,12-trienoate.
| Compound Name | [(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 162809906 |
| Molecular Formula | C39H62O5 |
| Molecular Weight | 610.92 g/mol |
| Exact Mass | 610.46 |
| IUPAC Name | [(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] octadeca-6,9,12-trienoate |
| SMILES | CCC=CCC=CCC=CCC=CCCCCC(=O)OC[C@H](CO)OC(=O)CCCCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C39H62O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-20,23-26,37,40H,3-4,6,8-10,15-16,21-22,27-36H2,1-2H3/t37-/m0/s1 |
| InChIKey | SHLHYPMEWIXGTP-QNGWXLTQSA-N |
| XLogP | 10.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.92 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|