C31H47N3O6 — CID 162813047
[2-[(8R,9R,10R,13R,14R,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(3-imidazolidin-1-ylpropylamino)-4-oxobutanoate (PubChem CID 162813047) has the molecular formula C31H47N3O6 and a molecular weight of 557.73 g/mol. Its IUPAC name is [2-[(8R,9R,10R,13R,14R,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(3-imidazolidin-1-ylpropylamino)-4-oxobutanoate.
| Compound Name | [2-[(8R,9R,10R,13R,14R,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(3-imidazolidin-1-ylpropylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 162813047 |
| Molecular Formula | C31H47N3O6 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | [2-[(8R,9R,10R,13R,14R,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(3-imidazolidin-1-ylpropylamino)-4-oxobutanoate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@H]2CC[C@]2(C)[C@@H]1CC[C@]2(O)C(=O)COC(=O)CCC(=O)NCCCN1CCNC1 |
| InChI | InChI=1S/C31H47N3O6/c1-29-11-8-22(35)18-21(29)4-5-23-24(29)9-12-30(2)25(23)10-13-31(30,39)26(36)19-40-28(38)7-6-27(37)33-14-3-16-34-17-15-32-20-34/h18,23-25,32,39H,3-17,19-20H2,1-2H3,(H,33,37)/t23-,24-,25-,29+,30-,31+/m1/s1 |
| InChIKey | XVCRFUHDXWFQLN-FSUQIAOFSA-N |
| XLogP | 2.51 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|