C31H45NO8 — CID 4839493
6-[[4-[2-(17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 4839493) has the molecular formula C31H45NO8 and a molecular weight of 559.70 g/mol. Its IUPAC name is 6-[[4-[2-(17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[2-(17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 4839493 |
| Molecular Formula | C31H45NO8 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 6-[[4-[2-(17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C1CCC2(O)C(=O)COC(=O)CCC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C31H45NO8/c1-29-14-11-21(33)18-20(29)7-8-22-23(29)12-15-30(2)24(22)13-16-31(30,39)25(34)19-40-28(38)10-9-26(35)32-17-5-3-4-6-27(36)37/h18,22-24,39H,3-17,19H2,1-2H3,(H,32,35)(H,36,37) |
| InChIKey | BKEPAPAGBZTIPU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|