C22H27N3O3S — CID 162813850
N-[(1R,9R)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]thiophene-2-carboxamide (PubChem CID 162813850) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[(1R,9R)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[(1R,9R)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162813850 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[(1R,9R)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]thiophene-2-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1C[C@H]2C[C@H](C1)c1ccc(NC(=O)c3cccs3)c(=O)n1C2 |
| InChI | InChI=1S/C22H27N3O3S/c1-22(2,3)10-19(26)24-11-14-9-15(13-24)17-7-6-16(21(28)25(17)12-14)23-20(27)18-5-4-8-29-18/h4-8,14-15H,9-13H2,1-3H3,(H,23,27)/t14-,15-/m1/s1 |
| InChIKey | JCSWZDOSZCSXLZ-HUUCEWRRSA-N |
| XLogP | 3.54 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |