C24H29ClN4O3 — CID 7142715
1-(4-chlorophenyl)-3-[(1R,9S)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]urea (PubChem CID 7142715) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1R,9S)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1R,9S)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]urea |
|---|---|
| PubChem CID | 7142715 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1R,9S)-11-(3,3-dimethylbutanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]urea |
| SMILES | CC(C)(C)CC(=O)N1C[C@@H]2C[C@H](C1)c1ccc(NC(=O)Nc3ccc(Cl)cc3)c(=O)n1C2 |
| InChI | InChI=1S/C24H29ClN4O3/c1-24(2,3)11-21(30)28-12-15-10-16(14-28)20-9-8-19(22(31)29(20)13-15)27-23(32)26-18-6-4-17(25)5-7-18/h4-9,15-16H,10-14H2,1-3H3,(H2,26,27,32)/t15-,16+/m0/s1 |
| InChIKey | STGMWRKUTMSITC-JKSUJKDBSA-N |
| XLogP | 4.53 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |