C10H18O4 — CID 162814553
6-(2,4-dihydroxypentyl)oxan-2-one (PubChem CID 162814553) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 6-(2,4-dihydroxypentyl)oxan-2-one.
| Compound Name | 6-(2,4-dihydroxypentyl)oxan-2-one |
|---|---|
| PubChem CID | 162814553 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 6-(2,4-dihydroxypentyl)oxan-2-one |
| SMILES | CC(O)CC(O)CC1CCCC(=O)O1 |
| InChI | InChI=1S/C10H18O4/c1-7(11)5-8(12)6-9-3-2-4-10(13)14-9/h7-9,11-12H,2-6H2,1H3 |
| InChIKey | MRFXFWDDKXBNOQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |