About [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate
[2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 20736092) has the molecular formula C21H28O5
and a molecular weight of 360.45 g/mol. Its IUPAC name is [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
Molecular Properties
| Compound Name | [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| PubChem CID | 20736092 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C1CCCC(CC(O)COC(=O)C2CC3CC2C2C4C=CC(C4)C32)O1 |
| InChI | InChI=1S/C21H28O5/c22-14(9-15-2-1-3-18(23)26-15)10-25-21(24)17-8-13-7-16(17)20-12-5-4-11(6-12)19(13)20/h4-5,11-17,19-20,22H,1-3,6-10H2 |
| InChIKey | QWKAVSLKVZOVJT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The IUPAC name of [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (CID 20736092) is [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
What is the SMILES notation for [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The canonical SMILES for [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is O=C1CCCC(CC(O)COC(=O)C2CC3CC2C2C4C=CC(C4)C32)O1.
What is the InChIKey of [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The InChIKey is QWKAVSLKVZOVJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O5/c22-14(9-15-2-1-3-18(23)26-15)10-25-21(24)17-8-13-7-16(17)20-12-5-4-11(6-12)19(13)20/h4-5,11-17,19-20,22H,1-3,6-10H2.
What are the key properties of [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
[2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate has a molecular weight of 360.45 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-3-(6-oxooxan-2-yl)propyl] tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is sourced from PubChem (CID 20736092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).