C19H22N2O4 — CID 162814721
1,1-dimethyl-5-(methylamino)-2-(3-oxobutanoyl)-9,9a-dihydro-3aH-benzo[f]isoindole-3,4-dione (PubChem CID 162814721) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1,1-dimethyl-5-(methylamino)-2-(3-oxobutanoyl)-9,9a-dihydro-3aH-benzo[f]isoindole-3,4-dione.
| Compound Name | 1,1-dimethyl-5-(methylamino)-2-(3-oxobutanoyl)-9,9a-dihydro-3aH-benzo[f]isoindole-3,4-dione |
|---|---|
| PubChem CID | 162814721 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1,1-dimethyl-5-(methylamino)-2-(3-oxobutanoyl)-9,9a-dihydro-3aH-benzo[f]isoindole-3,4-dione |
| SMILES | CNc1cccc2c1C(=O)C1C(=O)N(C(=O)CC(C)=O)C(C)(C)C1C2 |
| InChI | InChI=1S/C19H22N2O4/c1-10(22)8-14(23)21-18(25)16-12(19(21,2)3)9-11-6-5-7-13(20-4)15(11)17(16)24/h5-7,12,16,20H,8-9H2,1-4H3 |
| InChIKey | FRHIEXGDYQMFJP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|